C18H26ClFN2O4S — CID 130457762
5-chloro-N-(dimethylsulfamoyl)-4-(3-ethyl-2-methylhex-5-enoxy)-2-fluorobenzamide (PubChem CID 130457762) has the molecular formula C18H26ClFN2O4S and a molecular weight of 420.93 g/mol. Its IUPAC name is 5-chloro-N-(dimethylsulfamoyl)-4-(3-ethyl-2-methylhex-5-enoxy)-2-fluorobenzamide.
| Compound Name | 5-chloro-N-(dimethylsulfamoyl)-4-(3-ethyl-2-methylhex-5-enoxy)-2-fluorobenzamide |
|---|---|
| PubChem CID | 130457762 |
| Molecular Formula | C18H26ClFN2O4S |
| Molecular Weight | 420.93 g/mol |
| Exact Mass | 420.13 |
| IUPAC Name | 5-chloro-N-(dimethylsulfamoyl)-4-(3-ethyl-2-methylhex-5-enoxy)-2-fluorobenzamide |
| SMILES | C=CCC(CC)C(C)COc1cc(F)c(C(=O)NS(=O)(=O)N(C)C)cc1Cl |
| InChI | InChI=1S/C18H26ClFN2O4S/c1-6-8-13(7-2)12(3)11-26-17-10-16(20)14(9-15(17)19)18(23)21-27(24,25)22(4)5/h6,9-10,12-13H,1,7-8,11H2,2-5H3,(H,21,23) |
| InChIKey | CQHDTKWPULMWQO-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.93 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|