C15H10F2N2O4S — CID 66766760
4-(3-cyanophenoxy)-2,5-difluoro-N-methylsulfonylbenzamide (PubChem CID 66766760) has the molecular formula C15H10F2N2O4S and a molecular weight of 352.32 g/mol. Its IUPAC name is 4-(3-cyanophenoxy)-2,5-difluoro-N-methylsulfonylbenzamide.
| Compound Name | 4-(3-cyanophenoxy)-2,5-difluoro-N-methylsulfonylbenzamide |
|---|---|
| PubChem CID | 66766760 |
| Molecular Formula | C15H10F2N2O4S |
| Molecular Weight | 352.32 g/mol |
| Exact Mass | 352.03 |
| IUPAC Name | 4-(3-cyanophenoxy)-2,5-difluoro-N-methylsulfonylbenzamide |
| SMILES | CS(=O)(=O)NC(=O)c1cc(F)c(Oc2cccc(C#N)c2)cc1F |
| InChI | InChI=1S/C15H10F2N2O4S/c1-24(21,22)19-15(20)11-6-13(17)14(7-12(11)16)23-10-4-2-3-9(5-10)8-18/h2-7H,1H3,(H,19,20) |
| InChIKey | GOXQKZKKXFXOGP-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 96.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.32 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |