About cadmium(2+);bis(6-methylnaphthalene-1-carboxylate)
cadmium(2+);bis(6-methylnaphthalene-1-carboxylate) (PubChem CID 22604879) has the molecular formula C24H18CdO4
and a molecular weight of 482.82 g/mol. Its IUPAC name is cadmium(2+);bis(6-methylnaphthalene-1-carboxylate).
Molecular Properties
| Compound Name | cadmium(2+);bis(6-methylnaphthalene-1-carboxylate) |
| PubChem CID | 22604879 |
| Molecular Formula | C24H18CdO4 |
| Molecular Weight | 482.82 g/mol |
| Exact Mass | 484.02 |
| IUPAC Name | cadmium(2+);bis(6-methylnaphthalene-1-carboxylate) |
| SMILES | Cc1ccc2c(C(=O)[O-])cccc2c1.Cc1ccc2c(C(=O)[O-])cccc2c1.[Cd+2] |
| InChI | InChI=1S/2C12H10O2.Cd/c2*1-8-5-6-10-9(7-8)3-2-4-11(10)12(13)14;/h2*2-7H,1H3,(H,13,14);/q;;+2/p-2 |
| InChIKey | ILAYBUQTMNQYSK-UHFFFAOYSA-L |
| XLogP | 3.02 |
| TPSA | 80.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 482.82 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze cadmium(2+);bis(6-methylnaphthalene-1-carboxylate) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cadmium(2+);bis(6-methylnaphthalene-1-carboxylate)?
The IUPAC name of cadmium(2+);bis(6-methylnaphthalene-1-carboxylate) (CID 22604879) is cadmium(2+);bis(6-methylnaphthalene-1-carboxylate).
What is the SMILES notation for cadmium(2+);bis(6-methylnaphthalene-1-carboxylate)?
The canonical SMILES for cadmium(2+);bis(6-methylnaphthalene-1-carboxylate) is Cc1ccc2c(C(=O)[O-])cccc2c1.Cc1ccc2c(C(=O)[O-])cccc2c1.[Cd+2].
What is the InChIKey of cadmium(2+);bis(6-methylnaphthalene-1-carboxylate)?
The InChIKey is ILAYBUQTMNQYSK-UHFFFAOYSA-L. The full InChI is InChI=1S/2C12H10O2.Cd/c2*1-8-5-6-10-9(7-8)3-2-4-11(10)12(13)14;/h2*2-7H,1H3,(H,13,14);/q;;+2/p-2.
What are the key properties of cadmium(2+);bis(6-methylnaphthalene-1-carboxylate)?
cadmium(2+);bis(6-methylnaphthalene-1-carboxylate) has a molecular weight of 482.82 g/mol, XLogP of 3.02, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for cadmium(2+);bis(6-methylnaphthalene-1-carboxylate) is sourced from PubChem (CID 22604879), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).