C15H12MgO4 — CID 22987477
magnesium;2-methylprop-2-enoate;naphthalene-1-carboxylate (PubChem CID 22987477) has the molecular formula C15H12MgO4 and a molecular weight of 280.56 g/mol. Its IUPAC name is magnesium;2-methylprop-2-enoate;naphthalene-1-carboxylate.
| Compound Name | magnesium;2-methylprop-2-enoate;naphthalene-1-carboxylate |
|---|---|
| PubChem CID | 22987477 |
| Molecular Formula | C15H12MgO4 |
| Molecular Weight | 280.56 g/mol |
| Exact Mass | 280.06 |
| IUPAC Name | magnesium;2-methylprop-2-enoate;naphthalene-1-carboxylate |
| SMILES | C=C(C)C(=O)[O-].O=C([O-])c1cccc2ccccc12.[Mg+2] |
| InChI | InChI=1S/C11H8O2.C4H6O2.Mg/c12-11(13)10-7-3-5-8-4-1-2-6-9(8)10;1-3(2)4(5)6;/h1-7H,(H,12,13);1H2,2H3,(H,5,6);/q;;+2/p-2 |
| InChIKey | LMVMTEWXMUVJBX-UHFFFAOYSA-L |
| XLogP | 0.13 |
| TPSA | 80.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.56 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|