About zinc;2-methylprop-2-enoate;2-nitronaphthalene-1-carboxylate
zinc;2-methylprop-2-enoate;2-nitronaphthalene-1-carboxylate (PubChem CID 22987460) has the molecular formula C15H11NO6Zn
and a molecular weight of 366.64 g/mol. Its IUPAC name is zinc;2-methylprop-2-enoate;2-nitronaphthalene-1-carboxylate.
Molecular Properties
| Compound Name | zinc;2-methylprop-2-enoate;2-nitronaphthalene-1-carboxylate |
| PubChem CID | 22987460 |
| Molecular Formula | C15H11NO6Zn |
| Molecular Weight | 366.64 g/mol |
| Exact Mass | 364.99 |
| IUPAC Name | zinc;2-methylprop-2-enoate;2-nitronaphthalene-1-carboxylate |
| SMILES | C=C(C)C(=O)[O-].O=C([O-])c1c([N+](=O)[O-])ccc2ccccc12.[Zn+2] |
| InChI | InChI=1S/C11H7NO4.C4H6O2.Zn/c13-11(14)10-8-4-2-1-3-7(8)5-6-9(10)12(15)16;1-3(2)4(5)6;/h1-6H,(H,13,14);1H2,2H3,(H,5,6);/q;;+2/p-2 |
| InChIKey | GXVKJKLXRSGSDH-UHFFFAOYSA-L |
| XLogP | 0.42 |
| TPSA | 123.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 366.64 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze zinc;2-methylprop-2-enoate;2-nitronaphthalene-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of zinc;2-methylprop-2-enoate;2-nitronaphthalene-1-carboxylate?
The IUPAC name of zinc;2-methylprop-2-enoate;2-nitronaphthalene-1-carboxylate (CID 22987460) is zinc;2-methylprop-2-enoate;2-nitronaphthalene-1-carboxylate.
What is the SMILES notation for zinc;2-methylprop-2-enoate;2-nitronaphthalene-1-carboxylate?
The canonical SMILES for zinc;2-methylprop-2-enoate;2-nitronaphthalene-1-carboxylate is C=C(C)C(=O)[O-].O=C([O-])c1c([N+](=O)[O-])ccc2ccccc12.[Zn+2].
What is the InChIKey of zinc;2-methylprop-2-enoate;2-nitronaphthalene-1-carboxylate?
The InChIKey is GXVKJKLXRSGSDH-UHFFFAOYSA-L. The full InChI is InChI=1S/C11H7NO4.C4H6O2.Zn/c13-11(14)10-8-4-2-1-3-7(8)5-6-9(10)12(15)16;1-3(2)4(5)6;/h1-6H,(H,13,14);1H2,2H3,(H,5,6);/q;;+2/p-2.
What are the key properties of zinc;2-methylprop-2-enoate;2-nitronaphthalene-1-carboxylate?
zinc;2-methylprop-2-enoate;2-nitronaphthalene-1-carboxylate has a molecular weight of 366.64 g/mol, XLogP of 0.42, 3 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for zinc;2-methylprop-2-enoate;2-nitronaphthalene-1-carboxylate is sourced from PubChem (CID 22987460), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).