C12H6K2O4 — CID 101297429
dipotassium;naphthalene-1,4-dicarboxylate (PubChem CID 101297429) has the molecular formula C12H6K2O4 and a molecular weight of 292.37 g/mol. Its IUPAC name is dipotassium;naphthalene-1,4-dicarboxylate.
| Compound Name | dipotassium;naphthalene-1,4-dicarboxylate |
|---|---|
| PubChem CID | 101297429 |
| Molecular Formula | C12H6K2O4 |
| Molecular Weight | 292.37 g/mol |
| Exact Mass | 291.95 |
| IUPAC Name | dipotassium;naphthalene-1,4-dicarboxylate |
| SMILES | O=C([O-])c1ccc(C(=O)[O-])c2ccccc12.[K+].[K+] |
| InChI | InChI=1S/C12H8O4.2K/c13-11(14)9-5-6-10(12(15)16)8-4-2-1-3-7(8)9;;/h1-6H,(H,13,14)(H,15,16);;/q;2*+1/p-2 |
| InChIKey | KKSSHFGCRQXWKP-UHFFFAOYSA-L |
| XLogP | -6.43 |
| TPSA | 80.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.37 |
| LogP ≤ 5 | -6.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |