C12H10F3NO3 — CID 98042413
(2R)-3,3,3-trifluoro-2-(5-methoxy-1H-indol-3-yl)propanoic acid (PubChem CID 98042413) has the molecular formula C12H10F3NO3 and a molecular weight of 273.21 g/mol. Its IUPAC name is (2R)-3,3,3-trifluoro-2-(5-methoxy-1H-indol-3-yl)propanoic acid.
| Compound Name | (2R)-3,3,3-trifluoro-2-(5-methoxy-1H-indol-3-yl)propanoic acid |
|---|---|
| PubChem CID | 98042413 |
| Molecular Formula | C12H10F3NO3 |
| Molecular Weight | 273.21 g/mol |
| Exact Mass | 273.06 |
| IUPAC Name | (2R)-3,3,3-trifluoro-2-(5-methoxy-1H-indol-3-yl)propanoic acid |
| SMILES | COc1ccc2[nH]cc([C@H](C(=O)O)C(F)(F)F)c2c1 |
| InChI | InChI=1S/C12H10F3NO3/c1-19-6-2-3-9-7(4-6)8(5-16-9)10(11(17)18)12(13,14)15/h2-5,10,16H,1H3,(H,17,18)/t10-/m1/s1 |
| InChIKey | RISMSLRMPLYZJG-SNVBAGLBSA-N |
| XLogP | 2.91 |
| TPSA | 62.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.21 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |