C25H27NO3 — CID 129225134
4-(4-cyclohexylphenyl)-2-(5-methyl-1H-indol-3-yl)-4-oxobutanoic acid (PubChem CID 129225134) has the molecular formula C25H27NO3 and a molecular weight of 389.50 g/mol. Its IUPAC name is 4-(4-cyclohexylphenyl)-2-(5-methyl-1H-indol-3-yl)-4-oxobutanoic acid.
| Compound Name | 4-(4-cyclohexylphenyl)-2-(5-methyl-1H-indol-3-yl)-4-oxobutanoic acid |
|---|---|
| PubChem CID | 129225134 |
| Molecular Formula | C25H27NO3 |
| Molecular Weight | 389.50 g/mol |
| Exact Mass | 389.20 |
| IUPAC Name | 4-(4-cyclohexylphenyl)-2-(5-methyl-1H-indol-3-yl)-4-oxobutanoic acid |
| SMILES | Cc1ccc2[nH]cc(C(CC(=O)c3ccc(C4CCCCC4)cc3)C(=O)O)c2c1 |
| InChI | InChI=1S/C25H27NO3/c1-16-7-12-23-20(13-16)22(15-26-23)21(25(28)29)14-24(27)19-10-8-18(9-11-19)17-5-3-2-4-6-17/h7-13,15,17,21,26H,2-6,14H2,1H3,(H,28,29) |
| InChIKey | XVKDHPIEWBOCRJ-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 70.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.50 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |