C24H23N5O3 — CID 129225198
4-oxo-2-(5-pyridin-2-yl-1H-indol-3-yl)-4-[4-(triaminomethyl)phenyl]butanoic acid (PubChem CID 129225198) has the molecular formula C24H23N5O3 and a molecular weight of 429.48 g/mol. Its IUPAC name is 4-oxo-2-(5-pyridin-2-yl-1H-indol-3-yl)-4-[4-(triaminomethyl)phenyl]butanoic acid.
| Compound Name | 4-oxo-2-(5-pyridin-2-yl-1H-indol-3-yl)-4-[4-(triaminomethyl)phenyl]butanoic acid |
|---|---|
| PubChem CID | 129225198 |
| Molecular Formula | C24H23N5O3 |
| Molecular Weight | 429.48 g/mol |
| Exact Mass | 429.18 |
| IUPAC Name | 4-oxo-2-(5-pyridin-2-yl-1H-indol-3-yl)-4-[4-(triaminomethyl)phenyl]butanoic acid |
| SMILES | NC(N)(N)c1ccc(C(=O)CC(C(=O)O)c2c[nH]c3ccc(-c4ccccn4)cc23)cc1 |
| InChI | InChI=1S/C24H23N5O3/c25-24(26,27)16-7-4-14(5-8-16)22(30)12-18(23(31)32)19-13-29-21-9-6-15(11-17(19)21)20-3-1-2-10-28-20/h1-11,13,18,29H,12,25-27H2,(H,31,32) |
| InChIKey | VYWTWAGIERTLHK-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 161.11 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.48 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|