C11H14N4O2S — CID 87278638
aminothiourea;2-(1H-indol-3-yl)acetic acid (PubChem CID 87278638) has the molecular formula C11H14N4O2S and a molecular weight of 266.33 g/mol. Its IUPAC name is aminothiourea;2-(1H-indol-3-yl)acetic acid.
| Compound Name | aminothiourea;2-(1H-indol-3-yl)acetic acid |
|---|---|
| PubChem CID | 87278638 |
| Molecular Formula | C11H14N4O2S |
| Molecular Weight | 266.33 g/mol |
| Exact Mass | 266.08 |
| IUPAC Name | aminothiourea;2-(1H-indol-3-yl)acetic acid |
| SMILES | NNC(N)=S.O=C(O)Cc1c[nH]c2ccccc12 |
| InChI | InChI=1S/C10H9NO2.CH5N3S/c12-10(13)5-7-6-11-9-4-2-1-3-8(7)9;2-1(5)4-3/h1-4,6,11H,5H2,(H,12,13);3H2,(H3,2,4,5) |
| InChIKey | UATZJZDHVJDFJO-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 117.16 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.33 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|