C16H24N4O2S — CID 174487611
tert-butyl N-[1-(carbamothioylhydrazinylidene)-1-phenylbutan-2-yl]carbamate (PubChem CID 174487611) has the molecular formula C16H24N4O2S and a molecular weight of 336.46 g/mol. Its IUPAC name is tert-butyl N-[1-(carbamothioylhydrazinylidene)-1-phenylbutan-2-yl]carbamate.
| Compound Name | tert-butyl N-[1-(carbamothioylhydrazinylidene)-1-phenylbutan-2-yl]carbamate |
|---|---|
| PubChem CID | 174487611 |
| Molecular Formula | C16H24N4O2S |
| Molecular Weight | 336.46 g/mol |
| Exact Mass | 336.16 |
| IUPAC Name | tert-butyl N-[1-(carbamothioylhydrazinylidene)-1-phenylbutan-2-yl]carbamate |
| SMILES | CCC(NC(=O)OC(C)(C)C)C(=NNC(N)=S)c1ccccc1 |
| InChI | InChI=1S/C16H24N4O2S/c1-5-12(18-15(21)22-16(2,3)4)13(19-20-14(17)23)11-9-7-6-8-10-11/h6-10,12H,5H2,1-4H3,(H,18,21)(H3,17,20,23) |
| InChIKey | HTWCVGGITWWHEW-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 88.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.46 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|