C19H23Cl2N5O — CID 137028397
N-[N'-(4-chlorophenyl)carbamimidoyl]-4-(4-methylphenyl)piperazine-1-carboxamide;hydrochloride (PubChem CID 137028397) has the molecular formula C19H23Cl2N5O and a molecular weight of 408.33 g/mol. Its IUPAC name is N-[N'-(4-chlorophenyl)carbamimidoyl]-4-(4-methylphenyl)piperazine-1-carboxamide;hydrochloride.
| Compound Name | N-[N'-(4-chlorophenyl)carbamimidoyl]-4-(4-methylphenyl)piperazine-1-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 137028397 |
| Molecular Formula | C19H23Cl2N5O |
| Molecular Weight | 408.33 g/mol |
| Exact Mass | 407.13 |
| IUPAC Name | N-[N'-(4-chlorophenyl)carbamimidoyl]-4-(4-methylphenyl)piperazine-1-carboxamide;hydrochloride |
| SMILES | Cc1ccc(N2CCN(C(=O)N/C(N)=N/c3ccc(Cl)cc3)CC2)cc1.Cl |
| InChI | InChI=1S/C19H22ClN5O.ClH/c1-14-2-8-17(9-3-14)24-10-12-25(13-11-24)19(26)23-18(21)22-16-6-4-15(20)5-7-16;/h2-9H,10-13H2,1H3,(H3,21,22,23,26);1H |
| InChIKey | YUVPZUPZVIXSIC-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 73.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.33 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|