C14H17Cl2N3O2 — CID 43328946
4-(4-chlorophenyl)-N-(3-chloropropanoyl)piperazine-1-carboxamide (PubChem CID 43328946) has the molecular formula C14H17Cl2N3O2 and a molecular weight of 330.22 g/mol. Its IUPAC name is 4-(4-chlorophenyl)-N-(3-chloropropanoyl)piperazine-1-carboxamide.
| Compound Name | 4-(4-chlorophenyl)-N-(3-chloropropanoyl)piperazine-1-carboxamide |
|---|---|
| PubChem CID | 43328946 |
| Molecular Formula | C14H17Cl2N3O2 |
| Molecular Weight | 330.22 g/mol |
| Exact Mass | 329.07 |
| IUPAC Name | 4-(4-chlorophenyl)-N-(3-chloropropanoyl)piperazine-1-carboxamide |
| SMILES | O=C(CCCl)NC(=O)N1CCN(c2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C14H17Cl2N3O2/c15-6-5-13(20)17-14(21)19-9-7-18(8-10-19)12-3-1-11(16)2-4-12/h1-4H,5-10H2,(H,17,20,21) |
| InChIKey | QGJFESKYPHQCGW-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.22 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|