C22H20ClN3OS — CID 163329363
N-[4-(1H-benzimidazol-2-yl)phenyl]-2-(4-methylphenyl)sulfanylacetamide;hydrochloride (PubChem CID 163329363) has the molecular formula C22H20ClN3OS and a molecular weight of 409.94 g/mol. Its IUPAC name is N-[4-(1H-benzimidazol-2-yl)phenyl]-2-(4-methylphenyl)sulfanylacetamide;hydrochloride.
| Compound Name | N-[4-(1H-benzimidazol-2-yl)phenyl]-2-(4-methylphenyl)sulfanylacetamide;hydrochloride |
|---|---|
| PubChem CID | 163329363 |
| Molecular Formula | C22H20ClN3OS |
| Molecular Weight | 409.94 g/mol |
| Exact Mass | 409.10 |
| IUPAC Name | N-[4-(1H-benzimidazol-2-yl)phenyl]-2-(4-methylphenyl)sulfanylacetamide;hydrochloride |
| SMILES | Cc1ccc(SCC(=O)Nc2ccc(-c3nc4ccccc4[nH]3)cc2)cc1.Cl |
| InChI | InChI=1S/C22H19N3OS.ClH/c1-15-6-12-18(13-7-15)27-14-21(26)23-17-10-8-16(9-11-17)22-24-19-4-2-3-5-20(19)25-22;/h2-13H,14H2,1H3,(H,23,26)(H,24,25);1H |
| InChIKey | NRFUPNUDTBXQCP-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.94 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |