C22H18ClN3OS — CID 1231029
N-[4-(1H-benzimidazol-2-yl)phenyl]-2-[(2-chlorophenyl)methylsulfanyl]acetamide (PubChem CID 1231029) has the molecular formula C22H18ClN3OS and a molecular weight of 407.93 g/mol. Its IUPAC name is N-[4-(1H-benzimidazol-2-yl)phenyl]-2-[(2-chlorophenyl)methylsulfanyl]acetamide.
| Compound Name | N-[4-(1H-benzimidazol-2-yl)phenyl]-2-[(2-chlorophenyl)methylsulfanyl]acetamide |
|---|---|
| PubChem CID | 1231029 |
| Molecular Formula | C22H18ClN3OS |
| Molecular Weight | 407.93 g/mol |
| Exact Mass | 407.09 |
| IUPAC Name | N-[4-(1H-benzimidazol-2-yl)phenyl]-2-[(2-chlorophenyl)methylsulfanyl]acetamide |
| SMILES | O=C(CSCc1ccccc1Cl)Nc1ccc(-c2nc3ccccc3[nH]2)cc1 |
| InChI | InChI=1S/C22H18ClN3OS/c23-18-6-2-1-5-16(18)13-28-14-21(27)24-17-11-9-15(10-12-17)22-25-19-7-3-4-8-20(19)26-22/h1-12H,13-14H2,(H,24,27)(H,25,26) |
| InChIKey | YDXDAHTUVIYUAT-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.93 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |