C22H20N6O8 — CID 92531171
methyl (2E,3R)-5-(2-ethoxyanilino)-2-hydrazinylidene-3-(6-nitro-3-oxo-4H-quinoxalin-2-yl)-4,5-dioxopentanoate (PubChem CID 92531171) has the molecular formula C22H20N6O8 and a molecular weight of 496.44 g/mol. Its IUPAC name is methyl (2E,3R)-5-(2-ethoxyanilino)-2-hydrazinylidene-3-(6-nitro-3-oxo-4H-quinoxalin-2-yl)-4,5-dioxopentanoate.
| Compound Name | methyl (2E,3R)-5-(2-ethoxyanilino)-2-hydrazinylidene-3-(6-nitro-3-oxo-4H-quinoxalin-2-yl)-4,5-dioxopentanoate |
|---|---|
| PubChem CID | 92531171 |
| Molecular Formula | C22H20N6O8 |
| Molecular Weight | 496.44 g/mol |
| Exact Mass | 496.13 |
| IUPAC Name | methyl (2E,3R)-5-(2-ethoxyanilino)-2-hydrazinylidene-3-(6-nitro-3-oxo-4H-quinoxalin-2-yl)-4,5-dioxopentanoate |
| SMILES | CCOc1ccccc1NC(=O)C(=O)[C@@H](/C(=N\N)C(=O)OC)c1nc2ccc([N+](=O)[O-])cc2[nH]c1=O |
| InChI | InChI=1S/C22H20N6O8/c1-3-36-15-7-5-4-6-13(15)25-21(31)19(29)16(18(27-23)22(32)35-2)17-20(30)26-14-10-11(28(33)34)8-9-12(14)24-17/h4-10,16H,3,23H2,1-2H3,(H,25,31)(H,26,30)/b27-18+/t16-/m1/s1 |
| InChIKey | ZNRYJDLKGZESAJ-LBBJGNCOSA-N |
| XLogP | 1.01 |
| TPSA | 208.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.44 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|