C27H19N5O11-2 — CID 135720564
3-(6-benzoyl-3-oxo-4H-quinoxalin-2-yl)-1-hydroxy-1-[5-[hydroxy(oxido)amino]-2-nitroanilino]-5-methoxy-4,5-dioxopent-1-en-2-olate (PubChem CID 135720564) has the molecular formula C27H19N5O11-2 and a molecular weight of 589.47 g/mol. Its IUPAC name is 3-(6-benzoyl-3-oxo-4H-quinoxalin-2-yl)-1-hydroxy-1-[5-[hydroxy(oxido)amino]-2-nitroanilino]-5-methoxy-4,5-dioxopent-1-en-2-olate.
| Compound Name | 3-(6-benzoyl-3-oxo-4H-quinoxalin-2-yl)-1-hydroxy-1-[5-[hydroxy(oxido)amino]-2-nitroanilino]-5-methoxy-4,5-dioxopent-1-en-2-olate |
|---|---|
| PubChem CID | 135720564 |
| Molecular Formula | C27H19N5O11-2 |
| Molecular Weight | 589.47 g/mol |
| Exact Mass | 589.11 |
| IUPAC Name | 3-(6-benzoyl-3-oxo-4H-quinoxalin-2-yl)-1-hydroxy-1-[5-[hydroxy(oxido)amino]-2-nitroanilino]-5-methoxy-4,5-dioxopent-1-en-2-olate |
| SMILES | COC(=O)C(=O)C(C([O-])=C(O)Nc1cc(N([O-])O)ccc1[N+](=O)[O-])c1nc2ccc(C(=O)c3ccccc3)cc2[nH]c1=O |
| InChI | InChI=1S/C27H20N5O11/c1-43-27(38)24(35)20(23(34)26(37)30-18-12-15(31(39)40)8-10-19(18)32(41)42)21-25(36)29-17-11-14(7-9-16(17)28-21)22(33)13-5-3-2-4-6-13/h2-12,20,30,34,37,39H,1H3,(H,29,36)/q-1/p-1 |
| InChIKey | XWMJEVWURFQLEU-UHFFFAOYSA-M |
| XLogP | 1.78 |
| TPSA | 251.18 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.47 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|