C20H15N6O12-3 — CID 135720601
3-(6-dioxidoazaniumylidene-3-hydroxy-4H-quinoxalin-2-yl)-1-hydroxy-1-[4-[hydroxy(oxido)amino]-2-nitroanilino]-5-methoxy-4,5-dioxopent-1-en-2-olate (PubChem CID 135720601) has the molecular formula C20H15N6O12-3 and a molecular weight of 531.37 g/mol. Its IUPAC name is 3-(6-dioxidoazaniumylidene-3-hydroxy-4H-quinoxalin-2-yl)-1-hydroxy-1-[4-[hydroxy(oxido)amino]-2-nitroanilino]-5-methoxy-4,5-dioxopent-1-en-2-olate.
| Compound Name | 3-(6-dioxidoazaniumylidene-3-hydroxy-4H-quinoxalin-2-yl)-1-hydroxy-1-[4-[hydroxy(oxido)amino]-2-nitroanilino]-5-methoxy-4,5-dioxopent-1-en-2-olate |
|---|---|
| PubChem CID | 135720601 |
| Molecular Formula | C20H15N6O12-3 |
| Molecular Weight | 531.37 g/mol |
| Exact Mass | 531.08 |
| IUPAC Name | 3-(6-dioxidoazaniumylidene-3-hydroxy-4H-quinoxalin-2-yl)-1-hydroxy-1-[4-[hydroxy(oxido)amino]-2-nitroanilino]-5-methoxy-4,5-dioxopent-1-en-2-olate |
| SMILES | COC(=O)C(=O)C(C([O-])=C(O)Nc1ccc(N([O-])O)cc1[N+](=O)[O-])c1nc2ccc(=[N+]([O-])[O-])cc-2[nH]c1O |
| InChI | InChI=1S/C20H16N6O12/c1-38-20(31)17(28)14(15-18(29)23-12-6-8(24(32)33)2-4-10(12)21-15)16(27)19(30)22-11-5-3-9(25(34)35)7-13(11)26(36)37/h2-7,14,34H,1H3,(H5-,21,22,23,27,28,29,30,31,32,33)/q-2/p-1 |
| InChIKey | PISJZRYSJMWLSV-UHFFFAOYSA-M |
| XLogP | -0.39 |
| TPSA | 286.40 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.37 |
| LogP ≤ 5 | -0.39 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|