C24H15Cl2N3O9-2 — CID 135720583
4-(3,4-dichlorophenyl)-1-hydroxy-1-[4-[hydroxy(oxido)amino]-2-nitroanilino]-4-oxo-3-(3-oxo-1H-2-benzofuran-1-yl)but-1-en-2-olate (PubChem CID 135720583) has the molecular formula C24H15Cl2N3O9-2 and a molecular weight of 560.30 g/mol. Its IUPAC name is 4-(3,4-dichlorophenyl)-1-hydroxy-1-[4-[hydroxy(oxido)amino]-2-nitroanilino]-4-oxo-3-(3-oxo-1H-2-benzofuran-1-yl)but-1-en-2-olate.
| Compound Name | 4-(3,4-dichlorophenyl)-1-hydroxy-1-[4-[hydroxy(oxido)amino]-2-nitroanilino]-4-oxo-3-(3-oxo-1H-2-benzofuran-1-yl)but-1-en-2-olate |
|---|---|
| PubChem CID | 135720583 |
| Molecular Formula | C24H15Cl2N3O9-2 |
| Molecular Weight | 560.30 g/mol |
| Exact Mass | 559.02 |
| IUPAC Name | 4-(3,4-dichlorophenyl)-1-hydroxy-1-[4-[hydroxy(oxido)amino]-2-nitroanilino]-4-oxo-3-(3-oxo-1H-2-benzofuran-1-yl)but-1-en-2-olate |
| SMILES | O=C1OC(C(C(=O)c2ccc(Cl)c(Cl)c2)C([O-])=C(O)Nc2ccc(N([O-])O)cc2[N+](=O)[O-])c2ccccc21 |
| InChI | InChI=1S/C24H16Cl2N3O9/c25-15-7-5-11(9-16(15)26)20(30)19(22-13-3-1-2-4-14(13)24(33)38-22)21(31)23(32)27-17-8-6-12(28(34)35)10-18(17)29(36)37/h1-10,19,22,27,31-32,34H/q-1/p-1 |
| InChIKey | FIKFHGKTRHPBLK-UHFFFAOYSA-M |
| XLogP | 4.51 |
| TPSA | 188.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.30 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|