C24H14ClN3O9 — CID 4063589
N-(4-chloro-2-nitrophenyl)-4-(3-nitrophenyl)-2,4-dioxo-3-(3-oxo-1H-2-benzofuran-1-yl)butanamide (PubChem CID 4063589) has the molecular formula C24H14ClN3O9 and a molecular weight of 523.84 g/mol. Its IUPAC name is N-(4-chloro-2-nitrophenyl)-4-(3-nitrophenyl)-2,4-dioxo-3-(3-oxo-1H-2-benzofuran-1-yl)butanamide.
| Compound Name | N-(4-chloro-2-nitrophenyl)-4-(3-nitrophenyl)-2,4-dioxo-3-(3-oxo-1H-2-benzofuran-1-yl)butanamide |
|---|---|
| PubChem CID | 4063589 |
| Molecular Formula | C24H14ClN3O9 |
| Molecular Weight | 523.84 g/mol |
| Exact Mass | 523.04 |
| IUPAC Name | N-(4-chloro-2-nitrophenyl)-4-(3-nitrophenyl)-2,4-dioxo-3-(3-oxo-1H-2-benzofuran-1-yl)butanamide |
| SMILES | O=C(Nc1ccc(Cl)cc1[N+](=O)[O-])C(=O)C(C(=O)c1cccc([N+](=O)[O-])c1)C1OC(=O)c2ccccc21 |
| InChI | InChI=1S/C24H14ClN3O9/c25-13-8-9-17(18(11-13)28(35)36)26-23(31)21(30)19(20(29)12-4-3-5-14(10-12)27(33)34)22-15-6-1-2-7-16(15)24(32)37-22/h1-11,19,22H,(H,26,31) |
| InChIKey | CQWFMTQWEVGWJX-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 175.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.84 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|