C24H15FN2O7 — CID 98134114
(3S)-4-(2-fluorophenyl)-N-(3-nitrophenyl)-2,4-dioxo-3-[(1S)-3-oxo-1H-2-benzofuran-1-yl]butanamide (PubChem CID 98134114) has the molecular formula C24H15FN2O7 and a molecular weight of 462.39 g/mol. Its IUPAC name is (3S)-4-(2-fluorophenyl)-N-(3-nitrophenyl)-2,4-dioxo-3-[(1S)-3-oxo-1H-2-benzofuran-1-yl]butanamide.
| Compound Name | (3S)-4-(2-fluorophenyl)-N-(3-nitrophenyl)-2,4-dioxo-3-[(1S)-3-oxo-1H-2-benzofuran-1-yl]butanamide |
|---|---|
| PubChem CID | 98134114 |
| Molecular Formula | C24H15FN2O7 |
| Molecular Weight | 462.39 g/mol |
| Exact Mass | 462.09 |
| IUPAC Name | (3S)-4-(2-fluorophenyl)-N-(3-nitrophenyl)-2,4-dioxo-3-[(1S)-3-oxo-1H-2-benzofuran-1-yl]butanamide |
| SMILES | O=C(Nc1cccc([N+](=O)[O-])c1)C(=O)[C@H](C(=O)c1ccccc1F)[C@@H]1OC(=O)c2ccccc21 |
| InChI | InChI=1S/C24H15FN2O7/c25-18-11-4-3-10-17(18)20(28)19(22-15-8-1-2-9-16(15)24(31)34-22)21(29)23(30)26-13-6-5-7-14(12-13)27(32)33/h1-12,19,22H,(H,26,30)/t19-,22+/m0/s1 |
| InChIKey | ITHMPMZHFBGZRX-SIKLNZKXSA-N |
| XLogP | 3.65 |
| TPSA | 132.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.39 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|