C37H27N5O9S — CID 5143133
N-[[4-(3-nitroanilino)-3,4-dioxo-2-(3-oxo-1H-2-benzofuran-1-yl)-1-(2-phenylphenyl)butylidene]amino]-2-sulfamoylbenzamide (PubChem CID 5143133) has the molecular formula C37H27N5O9S and a molecular weight of 717.72 g/mol. Its IUPAC name is N-[[4-(3-nitroanilino)-3,4-dioxo-2-(3-oxo-1H-2-benzofuran-1-yl)-1-(2-phenylphenyl)butylidene]amino]-2-sulfamoylbenzamide.
| Compound Name | N-[[4-(3-nitroanilino)-3,4-dioxo-2-(3-oxo-1H-2-benzofuran-1-yl)-1-(2-phenylphenyl)butylidene]amino]-2-sulfamoylbenzamide |
|---|---|
| PubChem CID | 5143133 |
| Molecular Formula | C37H27N5O9S |
| Molecular Weight | 717.72 g/mol |
| Exact Mass | 717.15 |
| IUPAC Name | N-[[4-(3-nitroanilino)-3,4-dioxo-2-(3-oxo-1H-2-benzofuran-1-yl)-1-(2-phenylphenyl)butylidene]amino]-2-sulfamoylbenzamide |
| SMILES | NS(=O)(=O)c1ccccc1C(=O)NN=C(c1ccccc1-c1ccccc1)C(C(=O)C(=O)Nc1cccc([N+](=O)[O-])c1)C1OC(=O)c2ccccc21 |
| InChI | InChI=1S/C37H27N5O9S/c38-52(49,50)30-20-9-8-19-29(30)35(44)41-40-32(26-16-5-4-15-25(26)22-11-2-1-3-12-22)31(34-27-17-6-7-18-28(27)37(46)51-34)33(43)36(45)39-23-13-10-14-24(21-23)42(47)48/h1-21,31,34H,(H,39,45)(H,41,44)(H2,38,49,50) |
| InChIKey | GZHQFZRPWIXPLD-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 217.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 52 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 717.72 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|