C24H18ClN3O6 — CID 98557388
(2E,3S)-N-(3-chlorophenyl)-4-(2,4-dihydroxyphenyl)-2-hydrazinylidene-4-oxo-3-[(1R)-3-oxo-1H-2-benzofuran-1-yl]butanamide (PubChem CID 98557388) has the molecular formula C24H18ClN3O6 and a molecular weight of 479.88 g/mol. Its IUPAC name is (2E,3S)-N-(3-chlorophenyl)-4-(2,4-dihydroxyphenyl)-2-hydrazinylidene-4-oxo-3-[(1R)-3-oxo-1H-2-benzofuran-1-yl]butanamide.
| Compound Name | (2E,3S)-N-(3-chlorophenyl)-4-(2,4-dihydroxyphenyl)-2-hydrazinylidene-4-oxo-3-[(1R)-3-oxo-1H-2-benzofuran-1-yl]butanamide |
|---|---|
| PubChem CID | 98557388 |
| Molecular Formula | C24H18ClN3O6 |
| Molecular Weight | 479.88 g/mol |
| Exact Mass | 479.09 |
| IUPAC Name | (2E,3S)-N-(3-chlorophenyl)-4-(2,4-dihydroxyphenyl)-2-hydrazinylidene-4-oxo-3-[(1R)-3-oxo-1H-2-benzofuran-1-yl]butanamide |
| SMILES | N/N=C(/C(=O)Nc1cccc(Cl)c1)[C@H](C(=O)c1ccc(O)cc1O)[C@H]1OC(=O)c2ccccc21 |
| InChI | InChI=1S/C24H18ClN3O6/c25-12-4-3-5-13(10-12)27-23(32)20(28-26)19(21(31)17-9-8-14(29)11-18(17)30)22-15-6-1-2-7-16(15)24(33)34-22/h1-11,19,22,29-30H,26H2,(H,27,32)/b28-20+/t19-,22+/m1/s1 |
| InChIKey | KMBSUMWQGOTQHW-XJCBLUKISA-N |
| XLogP | 3.42 |
| TPSA | 151.31 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.88 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|