C30H20ClNO5 — CID 98388363
(3R)-N-(4-chlorophenyl)-2,4-dioxo-3-[(1R)-3-oxo-1H-2-benzofuran-1-yl]-4-(2-phenylphenyl)butanamide (PubChem CID 98388363) has the molecular formula C30H20ClNO5 and a molecular weight of 509.95 g/mol. Its IUPAC name is (3R)-N-(4-chlorophenyl)-2,4-dioxo-3-[(1R)-3-oxo-1H-2-benzofuran-1-yl]-4-(2-phenylphenyl)butanamide.
| Compound Name | (3R)-N-(4-chlorophenyl)-2,4-dioxo-3-[(1R)-3-oxo-1H-2-benzofuran-1-yl]-4-(2-phenylphenyl)butanamide |
|---|---|
| PubChem CID | 98388363 |
| Molecular Formula | C30H20ClNO5 |
| Molecular Weight | 509.95 g/mol |
| Exact Mass | 509.10 |
| IUPAC Name | (3R)-N-(4-chlorophenyl)-2,4-dioxo-3-[(1R)-3-oxo-1H-2-benzofuran-1-yl]-4-(2-phenylphenyl)butanamide |
| SMILES | O=C(Nc1ccc(Cl)cc1)C(=O)[C@@H](C(=O)c1ccccc1-c1ccccc1)[C@H]1OC(=O)c2ccccc21 |
| InChI | InChI=1S/C30H20ClNO5/c31-19-14-16-20(17-15-19)32-29(35)27(34)25(28-23-12-6-7-13-24(23)30(36)37-28)26(33)22-11-5-4-10-21(22)18-8-2-1-3-9-18/h1-17,25,28H,(H,32,35)/t25-,28+/m1/s1 |
| InChIKey | BHOBKTKWZATDJW-NAKRPHOHSA-N |
| XLogP | 5.93 |
| TPSA | 89.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.95 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|