C27H17ClF3NO5 — CID 6148734
(E)-N-[4-chloro-3-(trifluoromethyl)phenyl]-2,4-dioxo-3-(3-oxo-1H-2-benzofuran-1-yl)-6-phenylhex-5-enamide (PubChem CID 6148734) has the molecular formula C27H17ClF3NO5 and a molecular weight of 527.88 g/mol. Its IUPAC name is (E)-N-[4-chloro-3-(trifluoromethyl)phenyl]-2,4-dioxo-3-(3-oxo-1H-2-benzofuran-1-yl)-6-phenylhex-5-enamide.
| Compound Name | (E)-N-[4-chloro-3-(trifluoromethyl)phenyl]-2,4-dioxo-3-(3-oxo-1H-2-benzofuran-1-yl)-6-phenylhex-5-enamide |
|---|---|
| PubChem CID | 6148734 |
| Molecular Formula | C27H17ClF3NO5 |
| Molecular Weight | 527.88 g/mol |
| Exact Mass | 527.07 |
| IUPAC Name | (E)-N-[4-chloro-3-(trifluoromethyl)phenyl]-2,4-dioxo-3-(3-oxo-1H-2-benzofuran-1-yl)-6-phenylhex-5-enamide |
| SMILES | O=C(Nc1ccc(Cl)c(C(F)(F)F)c1)C(=O)C(C(=O)/C=C/c1ccccc1)C1OC(=O)c2ccccc21 |
| InChI | InChI=1S/C27H17ClF3NO5/c28-20-12-11-16(14-19(20)27(29,30)31)32-25(35)23(34)22(21(33)13-10-15-6-2-1-3-7-15)24-17-8-4-5-9-18(17)26(36)37-24/h1-14,22,24H,(H,32,35)/b13-10+ |
| InChIKey | OELAZIOOJNXHDH-JLHYYAGUSA-N |
| XLogP | 5.68 |
| TPSA | 89.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.88 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|