C31H29NO5 — CID 98385550
(Z,3S)-N-(2-tert-butyl-6-methylphenyl)-2,4-dioxo-3-[(1R)-3-oxo-1H-2-benzofuran-1-yl]-6-phenylhex-5-enamide (PubChem CID 98385550) has the molecular formula C31H29NO5 and a molecular weight of 495.58 g/mol. Its IUPAC name is (Z,3S)-N-(2-tert-butyl-6-methylphenyl)-2,4-dioxo-3-[(1R)-3-oxo-1H-2-benzofuran-1-yl]-6-phenylhex-5-enamide.
| Compound Name | (Z,3S)-N-(2-tert-butyl-6-methylphenyl)-2,4-dioxo-3-[(1R)-3-oxo-1H-2-benzofuran-1-yl]-6-phenylhex-5-enamide |
|---|---|
| PubChem CID | 98385550 |
| Molecular Formula | C31H29NO5 |
| Molecular Weight | 495.58 g/mol |
| Exact Mass | 495.20 |
| IUPAC Name | (Z,3S)-N-(2-tert-butyl-6-methylphenyl)-2,4-dioxo-3-[(1R)-3-oxo-1H-2-benzofuran-1-yl]-6-phenylhex-5-enamide |
| SMILES | Cc1cccc(C(C)(C)C)c1NC(=O)C(=O)[C@H](C(=O)/C=C\c1ccccc1)[C@H]1OC(=O)c2ccccc21 |
| InChI | InChI=1S/C31H29NO5/c1-19-11-10-16-23(31(2,3)4)26(19)32-29(35)27(34)25(24(33)18-17-20-12-6-5-7-13-20)28-21-14-8-9-15-22(21)30(36)37-28/h5-18,25,28H,1-4H3,(H,32,35)/b18-17-/t25-,28-/m0/s1 |
| InChIKey | FTTKFDCSVAEVNL-GXNHVJGDSA-N |
| XLogP | 5.61 |
| TPSA | 89.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.58 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|