C27H17N3O7 — CID 6014280
(E)-N-(2-cyano-4-nitrophenyl)-2,4-dioxo-3-(3-oxo-1H-2-benzofuran-1-yl)-6-phenylhex-5-enamide (PubChem CID 6014280) has the molecular formula C27H17N3O7 and a molecular weight of 495.45 g/mol. Its IUPAC name is (E)-N-(2-cyano-4-nitrophenyl)-2,4-dioxo-3-(3-oxo-1H-2-benzofuran-1-yl)-6-phenylhex-5-enamide.
| Compound Name | (E)-N-(2-cyano-4-nitrophenyl)-2,4-dioxo-3-(3-oxo-1H-2-benzofuran-1-yl)-6-phenylhex-5-enamide |
|---|---|
| PubChem CID | 6014280 |
| Molecular Formula | C27H17N3O7 |
| Molecular Weight | 495.45 g/mol |
| Exact Mass | 495.11 |
| IUPAC Name | (E)-N-(2-cyano-4-nitrophenyl)-2,4-dioxo-3-(3-oxo-1H-2-benzofuran-1-yl)-6-phenylhex-5-enamide |
| SMILES | N#Cc1cc([N+](=O)[O-])ccc1NC(=O)C(=O)C(C(=O)/C=C/c1ccccc1)C1OC(=O)c2ccccc21 |
| InChI | InChI=1S/C27H17N3O7/c28-15-17-14-18(30(35)36)11-12-21(17)29-26(33)24(32)23(22(31)13-10-16-6-2-1-3-7-16)25-19-8-4-5-9-20(19)27(34)37-25/h1-14,23,25H,(H,29,33)/b13-10+ |
| InChIKey | NADTWEFFTYQYFR-JLHYYAGUSA-N |
| XLogP | 3.78 |
| TPSA | 156.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.45 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|