C28H17N3O9 — CID 98389925
(3R)-N-(2,4-dinitrophenyl)-4-naphthalen-2-yl-2,4-dioxo-3-[(1S)-3-oxo-1H-2-benzofuran-1-yl]butanamide (PubChem CID 98389925) has the molecular formula C28H17N3O9 and a molecular weight of 539.46 g/mol. Its IUPAC name is (3R)-N-(2,4-dinitrophenyl)-4-naphthalen-2-yl-2,4-dioxo-3-[(1S)-3-oxo-1H-2-benzofuran-1-yl]butanamide.
| Compound Name | (3R)-N-(2,4-dinitrophenyl)-4-naphthalen-2-yl-2,4-dioxo-3-[(1S)-3-oxo-1H-2-benzofuran-1-yl]butanamide |
|---|---|
| PubChem CID | 98389925 |
| Molecular Formula | C28H17N3O9 |
| Molecular Weight | 539.46 g/mol |
| Exact Mass | 539.10 |
| IUPAC Name | (3R)-N-(2,4-dinitrophenyl)-4-naphthalen-2-yl-2,4-dioxo-3-[(1S)-3-oxo-1H-2-benzofuran-1-yl]butanamide |
| SMILES | O=C(Nc1ccc([N+](=O)[O-])cc1[N+](=O)[O-])C(=O)[C@@H](C(=O)c1ccc2ccccc2c1)[C@@H]1OC(=O)c2ccccc21 |
| InChI | InChI=1S/C28H17N3O9/c32-24(17-10-9-15-5-1-2-6-16(15)13-17)23(26-19-7-3-4-8-20(19)28(35)40-26)25(33)27(34)29-21-12-11-18(30(36)37)14-22(21)31(38)39/h1-14,23,26H,(H,29,34)/t23-,26-/m1/s1 |
| InChIKey | VFHXGINDQNUEFM-ZEQKJWHPSA-N |
| XLogP | 4.57 |
| TPSA | 175.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.46 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|