C29H18F3NO5 — CID 98387850
(3R)-4-naphthalen-2-yl-2,4-dioxo-3-[(1S)-3-oxo-1H-2-benzofuran-1-yl]-N-[3-(trifluoromethyl)phenyl]butanamide (PubChem CID 98387850) has the molecular formula C29H18F3NO5 and a molecular weight of 517.46 g/mol. Its IUPAC name is (3R)-4-naphthalen-2-yl-2,4-dioxo-3-[(1S)-3-oxo-1H-2-benzofuran-1-yl]-N-[3-(trifluoromethyl)phenyl]butanamide.
| Compound Name | (3R)-4-naphthalen-2-yl-2,4-dioxo-3-[(1S)-3-oxo-1H-2-benzofuran-1-yl]-N-[3-(trifluoromethyl)phenyl]butanamide |
|---|---|
| PubChem CID | 98387850 |
| Molecular Formula | C29H18F3NO5 |
| Molecular Weight | 517.46 g/mol |
| Exact Mass | 517.11 |
| IUPAC Name | (3R)-4-naphthalen-2-yl-2,4-dioxo-3-[(1S)-3-oxo-1H-2-benzofuran-1-yl]-N-[3-(trifluoromethyl)phenyl]butanamide |
| SMILES | O=C(Nc1cccc(C(F)(F)F)c1)C(=O)[C@@H](C(=O)c1ccc2ccccc2c1)[C@@H]1OC(=O)c2ccccc21 |
| InChI | InChI=1S/C29H18F3NO5/c30-29(31,32)19-8-5-9-20(15-19)33-27(36)25(35)23(26-21-10-3-4-11-22(21)28(37)38-26)24(34)18-13-12-16-6-1-2-7-17(16)14-18/h1-15,23,26H,(H,33,36)/t23-,26-/m1/s1 |
| InChIKey | DJZHPEBBJKDWBL-ZEQKJWHPSA-N |
| XLogP | 5.78 |
| TPSA | 89.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.46 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|