C25H14Cl2F3NO5 — CID 98389719
(3S)-4-(3,4-dichlorophenyl)-2,4-dioxo-3-[(1R)-3-oxo-1H-2-benzofuran-1-yl]-N-[3-(trifluoromethyl)phenyl]butanamide (PubChem CID 98389719) has the molecular formula C25H14Cl2F3NO5 and a molecular weight of 536.29 g/mol. Its IUPAC name is (3S)-4-(3,4-dichlorophenyl)-2,4-dioxo-3-[(1R)-3-oxo-1H-2-benzofuran-1-yl]-N-[3-(trifluoromethyl)phenyl]butanamide.
| Compound Name | (3S)-4-(3,4-dichlorophenyl)-2,4-dioxo-3-[(1R)-3-oxo-1H-2-benzofuran-1-yl]-N-[3-(trifluoromethyl)phenyl]butanamide |
|---|---|
| PubChem CID | 98389719 |
| Molecular Formula | C25H14Cl2F3NO5 |
| Molecular Weight | 536.29 g/mol |
| Exact Mass | 535.02 |
| IUPAC Name | (3S)-4-(3,4-dichlorophenyl)-2,4-dioxo-3-[(1R)-3-oxo-1H-2-benzofuran-1-yl]-N-[3-(trifluoromethyl)phenyl]butanamide |
| SMILES | O=C(Nc1cccc(C(F)(F)F)c1)C(=O)[C@H](C(=O)c1ccc(Cl)c(Cl)c1)[C@H]1OC(=O)c2ccccc21 |
| InChI | InChI=1S/C25H14Cl2F3NO5/c26-17-9-8-12(10-18(17)27)20(32)19(22-15-6-1-2-7-16(15)24(35)36-22)21(33)23(34)31-14-5-3-4-13(11-14)25(28,29)30/h1-11,19,22H,(H,31,34)/t19-,22-/m0/s1 |
| InChIKey | KFNAOMPDUGIGJS-UGKGYDQZSA-N |
| XLogP | 5.93 |
| TPSA | 89.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.29 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|