C24H15N4O7S- — CID 135720588
1-hydroxy-1-[(6-nitro-1,3-benzothiazol-2-yl)amino]-4-oxo-3-(3-oxo-1H-2-benzofuran-1-yl)-4-pyridin-4-ylbut-1-en-2-olate (PubChem CID 135720588) has the molecular formula C24H15N4O7S- and a molecular weight of 503.47 g/mol. Its IUPAC name is 1-hydroxy-1-[(6-nitro-1,3-benzothiazol-2-yl)amino]-4-oxo-3-(3-oxo-1H-2-benzofuran-1-yl)-4-pyridin-4-ylbut-1-en-2-olate.
| Compound Name | 1-hydroxy-1-[(6-nitro-1,3-benzothiazol-2-yl)amino]-4-oxo-3-(3-oxo-1H-2-benzofuran-1-yl)-4-pyridin-4-ylbut-1-en-2-olate |
|---|---|
| PubChem CID | 135720588 |
| Molecular Formula | C24H15N4O7S- |
| Molecular Weight | 503.47 g/mol |
| Exact Mass | 503.07 |
| IUPAC Name | 1-hydroxy-1-[(6-nitro-1,3-benzothiazol-2-yl)amino]-4-oxo-3-(3-oxo-1H-2-benzofuran-1-yl)-4-pyridin-4-ylbut-1-en-2-olate |
| SMILES | O=C1OC(C(C(=O)c2ccncc2)C([O-])=C(O)Nc2nc3ccc([N+](=O)[O-])cc3s2)c2ccccc21 |
| InChI | InChI=1S/C24H16N4O7S/c29-19(12-7-9-25-10-8-12)18(21-14-3-1-2-4-15(14)23(32)35-21)20(30)22(31)27-24-26-16-6-5-13(28(33)34)11-17(16)36-24/h1-11,18,21,30-31H,(H,26,27)/p-1 |
| InChIKey | IZDPIOFXEJQUKV-UHFFFAOYSA-M |
| XLogP | 3.51 |
| TPSA | 167.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.47 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|