C25H17N3O6S — CID 124553033
(3S)-N-(6-methoxy-1,3-benzothiazol-2-yl)-2,4-dioxo-3-[(1S)-3-oxo-1H-2-benzofuran-1-yl]-4-pyridin-4-ylbutanamide (PubChem CID 124553033) has the molecular formula C25H17N3O6S and a molecular weight of 487.49 g/mol. Its IUPAC name is (3S)-N-(6-methoxy-1,3-benzothiazol-2-yl)-2,4-dioxo-3-[(1S)-3-oxo-1H-2-benzofuran-1-yl]-4-pyridin-4-ylbutanamide.
| Compound Name | (3S)-N-(6-methoxy-1,3-benzothiazol-2-yl)-2,4-dioxo-3-[(1S)-3-oxo-1H-2-benzofuran-1-yl]-4-pyridin-4-ylbutanamide |
|---|---|
| PubChem CID | 124553033 |
| Molecular Formula | C25H17N3O6S |
| Molecular Weight | 487.49 g/mol |
| Exact Mass | 487.08 |
| IUPAC Name | (3S)-N-(6-methoxy-1,3-benzothiazol-2-yl)-2,4-dioxo-3-[(1S)-3-oxo-1H-2-benzofuran-1-yl]-4-pyridin-4-ylbutanamide |
| SMILES | COc1ccc2nc(NC(=O)C(=O)[C@H](C(=O)c3ccncc3)[C@@H]3OC(=O)c4ccccc43)sc2c1 |
| InChI | InChI=1S/C25H17N3O6S/c1-33-14-6-7-17-18(12-14)35-25(27-17)28-23(31)21(30)19(20(29)13-8-10-26-11-9-13)22-15-4-2-3-5-16(15)24(32)34-22/h2-12,19,22H,1H3,(H,27,28,31)/t19-,22+/m0/s1 |
| InChIKey | ZPWZUDBUGTYKFT-SIKLNZKXSA-N |
| XLogP | 3.62 |
| TPSA | 124.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.49 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|