C33H24N2O6S — CID 98134106
(3S)-N-(6-ethoxy-1,3-benzothiazol-2-yl)-2,4-dioxo-3-[(1R)-3-oxo-1H-2-benzofuran-1-yl]-4-(2-phenylphenyl)butanamide (PubChem CID 98134106) has the molecular formula C33H24N2O6S and a molecular weight of 576.63 g/mol. Its IUPAC name is (3S)-N-(6-ethoxy-1,3-benzothiazol-2-yl)-2,4-dioxo-3-[(1R)-3-oxo-1H-2-benzofuran-1-yl]-4-(2-phenylphenyl)butanamide.
| Compound Name | (3S)-N-(6-ethoxy-1,3-benzothiazol-2-yl)-2,4-dioxo-3-[(1R)-3-oxo-1H-2-benzofuran-1-yl]-4-(2-phenylphenyl)butanamide |
|---|---|
| PubChem CID | 98134106 |
| Molecular Formula | C33H24N2O6S |
| Molecular Weight | 576.63 g/mol |
| Exact Mass | 576.14 |
| IUPAC Name | (3S)-N-(6-ethoxy-1,3-benzothiazol-2-yl)-2,4-dioxo-3-[(1R)-3-oxo-1H-2-benzofuran-1-yl]-4-(2-phenylphenyl)butanamide |
| SMILES | CCOc1ccc2nc(NC(=O)C(=O)[C@H](C(=O)c3ccccc3-c3ccccc3)[C@H]3OC(=O)c4ccccc43)sc2c1 |
| InChI | InChI=1S/C33H24N2O6S/c1-2-40-20-16-17-25-26(18-20)42-33(34-25)35-31(38)29(37)27(30-23-14-8-9-15-24(23)32(39)41-30)28(36)22-13-7-6-12-21(22)19-10-4-3-5-11-19/h3-18,27,30H,2H2,1H3,(H,34,35,38)/t27-,30-/m0/s1 |
| InChIKey | ZEKACKAXHHKHOA-FIBWVYCGSA-N |
| XLogP | 6.28 |
| TPSA | 111.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.63 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|