C32H23NO7 — CID 98131438
methyl 2-[[(3S)-2,4-dioxo-3-[(1R)-3-oxo-1H-2-benzofuran-1-yl]-4-(2-phenylphenyl)butanoyl]amino]benzoate (PubChem CID 98131438) has the molecular formula C32H23NO7 and a molecular weight of 533.54 g/mol. Its IUPAC name is methyl 2-[[(3S)-2,4-dioxo-3-[(1R)-3-oxo-1H-2-benzofuran-1-yl]-4-(2-phenylphenyl)butanoyl]amino]benzoate.
| Compound Name | methyl 2-[[(3S)-2,4-dioxo-3-[(1R)-3-oxo-1H-2-benzofuran-1-yl]-4-(2-phenylphenyl)butanoyl]amino]benzoate |
|---|---|
| PubChem CID | 98131438 |
| Molecular Formula | C32H23NO7 |
| Molecular Weight | 533.54 g/mol |
| Exact Mass | 533.15 |
| IUPAC Name | methyl 2-[[(3S)-2,4-dioxo-3-[(1R)-3-oxo-1H-2-benzofuran-1-yl]-4-(2-phenylphenyl)butanoyl]amino]benzoate |
| SMILES | COC(=O)c1ccccc1NC(=O)C(=O)[C@H](C(=O)c1ccccc1-c1ccccc1)[C@H]1OC(=O)c2ccccc21 |
| InChI | InChI=1S/C32H23NO7/c1-39-31(37)24-17-9-10-18-25(24)33-30(36)28(35)26(29-22-15-7-8-16-23(22)32(38)40-29)27(34)21-14-6-5-13-20(21)19-11-3-2-4-12-19/h2-18,26,29H,1H3,(H,33,36)/t26-,29-/m0/s1 |
| InChIKey | IODKUZOLUHJWTB-WNJJXGMVSA-N |
| XLogP | 5.06 |
| TPSA | 115.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.54 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|