C26H17Cl2NO6 — CID 98390390
(3R)-N-(4-acetylphenyl)-4-(3,4-dichlorophenyl)-2,4-dioxo-3-[(1R)-3-oxo-1H-2-benzofuran-1-yl]butanamide (PubChem CID 98390390) has the molecular formula C26H17Cl2NO6 and a molecular weight of 510.33 g/mol. Its IUPAC name is (3R)-N-(4-acetylphenyl)-4-(3,4-dichlorophenyl)-2,4-dioxo-3-[(1R)-3-oxo-1H-2-benzofuran-1-yl]butanamide.
| Compound Name | (3R)-N-(4-acetylphenyl)-4-(3,4-dichlorophenyl)-2,4-dioxo-3-[(1R)-3-oxo-1H-2-benzofuran-1-yl]butanamide |
|---|---|
| PubChem CID | 98390390 |
| Molecular Formula | C26H17Cl2NO6 |
| Molecular Weight | 510.33 g/mol |
| Exact Mass | 509.04 |
| IUPAC Name | (3R)-N-(4-acetylphenyl)-4-(3,4-dichlorophenyl)-2,4-dioxo-3-[(1R)-3-oxo-1H-2-benzofuran-1-yl]butanamide |
| SMILES | CC(=O)c1ccc(NC(=O)C(=O)[C@@H](C(=O)c2ccc(Cl)c(Cl)c2)[C@H]2OC(=O)c3ccccc32)cc1 |
| InChI | InChI=1S/C26H17Cl2NO6/c1-13(30)14-6-9-16(10-7-14)29-25(33)23(32)21(22(31)15-8-11-19(27)20(28)12-15)24-17-4-2-3-5-18(17)26(34)35-24/h2-12,21,24H,1H3,(H,29,33)/t21-,24+/m1/s1 |
| InChIKey | FHVIPLRTYBLADV-QPPBQGQZSA-N |
| XLogP | 5.11 |
| TPSA | 106.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.33 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|