C24H16FNO5 — CID 98394680
(3R)-4-(2-fluorophenyl)-2,4-dioxo-3-[(1S)-3-oxo-1H-2-benzofuran-1-yl]-N-phenylbutanamide (PubChem CID 98394680) has the molecular formula C24H16FNO5 and a molecular weight of 417.39 g/mol. Its IUPAC name is (3R)-4-(2-fluorophenyl)-2,4-dioxo-3-[(1S)-3-oxo-1H-2-benzofuran-1-yl]-N-phenylbutanamide.
| Compound Name | (3R)-4-(2-fluorophenyl)-2,4-dioxo-3-[(1S)-3-oxo-1H-2-benzofuran-1-yl]-N-phenylbutanamide |
|---|---|
| PubChem CID | 98394680 |
| Molecular Formula | C24H16FNO5 |
| Molecular Weight | 417.39 g/mol |
| Exact Mass | 417.10 |
| IUPAC Name | (3R)-4-(2-fluorophenyl)-2,4-dioxo-3-[(1S)-3-oxo-1H-2-benzofuran-1-yl]-N-phenylbutanamide |
| SMILES | O=C(Nc1ccccc1)C(=O)[C@@H](C(=O)c1ccccc1F)[C@@H]1OC(=O)c2ccccc21 |
| InChI | InChI=1S/C24H16FNO5/c25-18-13-7-6-12-17(18)20(27)19(21(28)23(29)26-14-8-2-1-3-9-14)22-15-10-4-5-11-16(15)24(30)31-22/h1-13,19,22H,(H,26,29)/t19-,22-/m1/s1 |
| InChIKey | DBBVNDGQANXYMF-DENIHFKCSA-N |
| XLogP | 3.74 |
| TPSA | 89.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.39 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|