C30H23NO5 — CID 98131445
(3S)-N-(2,3-dimethylphenyl)-4-naphthalen-2-yl-2,4-dioxo-3-[(1R)-3-oxo-1H-2-benzofuran-1-yl]butanamide (PubChem CID 98131445) has the molecular formula C30H23NO5 and a molecular weight of 477.52 g/mol. Its IUPAC name is (3S)-N-(2,3-dimethylphenyl)-4-naphthalen-2-yl-2,4-dioxo-3-[(1R)-3-oxo-1H-2-benzofuran-1-yl]butanamide.
| Compound Name | (3S)-N-(2,3-dimethylphenyl)-4-naphthalen-2-yl-2,4-dioxo-3-[(1R)-3-oxo-1H-2-benzofuran-1-yl]butanamide |
|---|---|
| PubChem CID | 98131445 |
| Molecular Formula | C30H23NO5 |
| Molecular Weight | 477.52 g/mol |
| Exact Mass | 477.16 |
| IUPAC Name | (3S)-N-(2,3-dimethylphenyl)-4-naphthalen-2-yl-2,4-dioxo-3-[(1R)-3-oxo-1H-2-benzofuran-1-yl]butanamide |
| SMILES | Cc1cccc(NC(=O)C(=O)[C@H](C(=O)c2ccc3ccccc3c2)[C@H]2OC(=O)c3ccccc32)c1C |
| InChI | InChI=1S/C30H23NO5/c1-17-8-7-13-24(18(17)2)31-29(34)27(33)25(28-22-11-5-6-12-23(22)30(35)36-28)26(32)21-15-14-19-9-3-4-10-20(19)16-21/h3-16,25,28H,1-2H3,(H,31,34)/t25-,28-/m0/s1 |
| InChIKey | PISVECFSJKJLAU-LSYYVWMOSA-N |
| XLogP | 5.38 |
| TPSA | 89.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.52 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|