C32H27N5O7S — CID 98297406
N-[(E)-[(3S)-1-(2,3-dimethylanilino)-1,4-dioxo-3-[(1R)-3-oxo-1H-2-benzofuran-1-yl]-4-pyridin-4-ylbutan-2-ylidene]amino]-2-sulfamoylbenzamide (PubChem CID 98297406) has the molecular formula C32H27N5O7S and a molecular weight of 625.66 g/mol. Its IUPAC name is N-[(E)-[(3S)-1-(2,3-dimethylanilino)-1,4-dioxo-3-[(1R)-3-oxo-1H-2-benzofuran-1-yl]-4-pyridin-4-ylbutan-2-ylidene]amino]-2-sulfamoylbenzamide.
| Compound Name | N-[(E)-[(3S)-1-(2,3-dimethylanilino)-1,4-dioxo-3-[(1R)-3-oxo-1H-2-benzofuran-1-yl]-4-pyridin-4-ylbutan-2-ylidene]amino]-2-sulfamoylbenzamide |
|---|---|
| PubChem CID | 98297406 |
| Molecular Formula | C32H27N5O7S |
| Molecular Weight | 625.66 g/mol |
| Exact Mass | 625.16 |
| IUPAC Name | N-[(E)-[(3S)-1-(2,3-dimethylanilino)-1,4-dioxo-3-[(1R)-3-oxo-1H-2-benzofuran-1-yl]-4-pyridin-4-ylbutan-2-ylidene]amino]-2-sulfamoylbenzamide |
| SMILES | Cc1cccc(NC(=O)/C(=N/NC(=O)c2ccccc2S(N)(=O)=O)[C@H](C(=O)c2ccncc2)[C@H]2OC(=O)c3ccccc32)c1C |
| InChI | InChI=1S/C32H27N5O7S/c1-18-8-7-12-24(19(18)2)35-31(40)27(36-37-30(39)23-11-5-6-13-25(23)45(33,42)43)26(28(38)20-14-16-34-17-15-20)29-21-9-3-4-10-22(21)32(41)44-29/h3-17,26,29H,1-2H3,(H,35,40)(H,37,39)(H2,33,42,43)/b36-27+/t26-,29+/m1/s1 |
| InChIKey | RWMHDZKDGDAVDP-TWPVRSTASA-N |
| XLogP | 3.48 |
| TPSA | 186.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 625.66 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|