C26H20N2O7 — CID 124632095
(3S)-N-(2,4-dimethylphenyl)-4-(3-nitrophenyl)-2,4-dioxo-3-[(1R)-3-oxo-1H-2-benzofuran-1-yl]butanamide (PubChem CID 124632095) has the molecular formula C26H20N2O7 and a molecular weight of 472.45 g/mol. Its IUPAC name is (3S)-N-(2,4-dimethylphenyl)-4-(3-nitrophenyl)-2,4-dioxo-3-[(1R)-3-oxo-1H-2-benzofuran-1-yl]butanamide.
| Compound Name | (3S)-N-(2,4-dimethylphenyl)-4-(3-nitrophenyl)-2,4-dioxo-3-[(1R)-3-oxo-1H-2-benzofuran-1-yl]butanamide |
|---|---|
| PubChem CID | 124632095 |
| Molecular Formula | C26H20N2O7 |
| Molecular Weight | 472.45 g/mol |
| Exact Mass | 472.13 |
| IUPAC Name | (3S)-N-(2,4-dimethylphenyl)-4-(3-nitrophenyl)-2,4-dioxo-3-[(1R)-3-oxo-1H-2-benzofuran-1-yl]butanamide |
| SMILES | Cc1ccc(NC(=O)C(=O)[C@H](C(=O)c2cccc([N+](=O)[O-])c2)[C@H]2OC(=O)c3ccccc32)c(C)c1 |
| InChI | InChI=1S/C26H20N2O7/c1-14-10-11-20(15(2)12-14)27-25(31)23(30)21(22(29)16-6-5-7-17(13-16)28(33)34)24-18-8-3-4-9-19(18)26(32)35-24/h3-13,21,24H,1-2H3,(H,27,31)/t21-,24-/m0/s1 |
| InChIKey | NTIQSSGVNSGONP-URXFXBBRSA-N |
| XLogP | 4.13 |
| TPSA | 132.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.45 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|