C31H22N2O7 — CID 98392930
(3S)-N-(2-methyl-4-nitrophenyl)-2,4-dioxo-3-[(1S)-3-oxo-1H-2-benzofuran-1-yl]-4-(2-phenylphenyl)butanamide (PubChem CID 98392930) has the molecular formula C31H22N2O7 and a molecular weight of 534.52 g/mol. Its IUPAC name is (3S)-N-(2-methyl-4-nitrophenyl)-2,4-dioxo-3-[(1S)-3-oxo-1H-2-benzofuran-1-yl]-4-(2-phenylphenyl)butanamide.
| Compound Name | (3S)-N-(2-methyl-4-nitrophenyl)-2,4-dioxo-3-[(1S)-3-oxo-1H-2-benzofuran-1-yl]-4-(2-phenylphenyl)butanamide |
|---|---|
| PubChem CID | 98392930 |
| Molecular Formula | C31H22N2O7 |
| Molecular Weight | 534.52 g/mol |
| Exact Mass | 534.14 |
| IUPAC Name | (3S)-N-(2-methyl-4-nitrophenyl)-2,4-dioxo-3-[(1S)-3-oxo-1H-2-benzofuran-1-yl]-4-(2-phenylphenyl)butanamide |
| SMILES | Cc1cc([N+](=O)[O-])ccc1NC(=O)C(=O)[C@H](C(=O)c1ccccc1-c1ccccc1)[C@@H]1OC(=O)c2ccccc21 |
| InChI | InChI=1S/C31H22N2O7/c1-18-17-20(33(38)39)15-16-25(18)32-30(36)28(35)26(29-23-13-7-8-14-24(23)31(37)40-29)27(34)22-12-6-5-11-21(22)19-9-3-2-4-10-19/h2-17,26,29H,1H3,(H,32,36)/t26-,29+/m0/s1 |
| InChIKey | VIMRAHCTUDYZIT-LITSAYRRSA-N |
| XLogP | 5.49 |
| TPSA | 132.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.52 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|