C16H10BrClF3NO — CID 4072285
2-bromo-N-[4-chloro-3-(trifluoromethyl)phenyl]-3-phenylprop-2-enamide (PubChem CID 4072285) has the molecular formula C16H10BrClF3NO and a molecular weight of 404.61 g/mol. Its IUPAC name is 2-bromo-N-[4-chloro-3-(trifluoromethyl)phenyl]-3-phenylprop-2-enamide.
| Compound Name | 2-bromo-N-[4-chloro-3-(trifluoromethyl)phenyl]-3-phenylprop-2-enamide |
|---|---|
| PubChem CID | 4072285 |
| Molecular Formula | C16H10BrClF3NO |
| Molecular Weight | 404.61 g/mol |
| Exact Mass | 402.96 |
| IUPAC Name | 2-bromo-N-[4-chloro-3-(trifluoromethyl)phenyl]-3-phenylprop-2-enamide |
| SMILES | O=C(Nc1ccc(Cl)c(C(F)(F)F)c1)C(Br)=Cc1ccccc1 |
| InChI | InChI=1S/C16H10BrClF3NO/c17-13(8-10-4-2-1-3-5-10)15(23)22-11-6-7-14(18)12(9-11)16(19,20)21/h1-9H,(H,22,23) |
| InChIKey | CPSWVBIYZWLZCA-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.61 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|