C18H14Cl2N6O5S — CID 92531150
(2E,3R)-2-(aminocarbamothioylhydrazinylidene)-N-(3,4-dichlorophenyl)-3-nitro-3-[(1R)-3-oxo-1H-2-benzofuran-1-yl]propanamide (PubChem CID 92531150) has the molecular formula C18H14Cl2N6O5S and a molecular weight of 497.32 g/mol. Its IUPAC name is (2E,3R)-2-(aminocarbamothioylhydrazinylidene)-N-(3,4-dichlorophenyl)-3-nitro-3-[(1R)-3-oxo-1H-2-benzofuran-1-yl]propanamide.
| Compound Name | (2E,3R)-2-(aminocarbamothioylhydrazinylidene)-N-(3,4-dichlorophenyl)-3-nitro-3-[(1R)-3-oxo-1H-2-benzofuran-1-yl]propanamide |
|---|---|
| PubChem CID | 92531150 |
| Molecular Formula | C18H14Cl2N6O5S |
| Molecular Weight | 497.32 g/mol |
| Exact Mass | 496.01 |
| IUPAC Name | (2E,3R)-2-(aminocarbamothioylhydrazinylidene)-N-(3,4-dichlorophenyl)-3-nitro-3-[(1R)-3-oxo-1H-2-benzofuran-1-yl]propanamide |
| SMILES | NNC(=S)N/N=C(/C(=O)Nc1ccc(Cl)c(Cl)c1)[C@H]([C@@H]1OC(=O)c2ccccc21)[N+](=O)[O-] |
| InChI | InChI=1S/C18H14Cl2N6O5S/c19-11-6-5-8(7-12(11)20)22-16(27)13(24-25-18(32)23-21)14(26(29)30)15-9-3-1-2-4-10(9)17(28)31-15/h1-7,14-15H,21H2,(H,22,27)(H2,23,25,32)/b24-13+/t14-,15-/m1/s1 |
| InChIKey | HBURQZBWTNGUJE-BDJKEWHFSA-N |
| XLogP | 2.18 |
| TPSA | 160.98 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.32 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|