C13H10ClNO2S — CID 135496307
N-(3-chlorophenyl)-2,4-dihydroxybenzenecarbothioamide (PubChem CID 135496307) has the molecular formula C13H10ClNO2S and a molecular weight of 279.75 g/mol. Its IUPAC name is N-(3-chlorophenyl)-2,4-dihydroxybenzenecarbothioamide.
| Compound Name | N-(3-chlorophenyl)-2,4-dihydroxybenzenecarbothioamide |
|---|---|
| PubChem CID | 135496307 |
| Molecular Formula | C13H10ClNO2S |
| Molecular Weight | 279.75 g/mol |
| Exact Mass | 279.01 |
| IUPAC Name | N-(3-chlorophenyl)-2,4-dihydroxybenzenecarbothioamide |
| SMILES | Oc1ccc(C(=S)Nc2cccc(Cl)c2)c(O)c1 |
| InChI | InChI=1S/C13H10ClNO2S/c14-8-2-1-3-9(6-8)15-13(18)11-5-4-10(16)7-12(11)17/h1-7,16-17H,(H,15,18) |
| InChIKey | TWRCDHVYULQUAT-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.75 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|