C18H15ClN4O8 — CID 55309521
[2-(4-chloro-2-nitroanilino)-2-oxoethyl] 2-[(3-nitrobenzoyl)amino]propanoate (PubChem CID 55309521) has the molecular formula C18H15ClN4O8 and a molecular weight of 450.79 g/mol. Its IUPAC name is [2-(4-chloro-2-nitroanilino)-2-oxoethyl] 2-[(3-nitrobenzoyl)amino]propanoate.
| Compound Name | [2-(4-chloro-2-nitroanilino)-2-oxoethyl] 2-[(3-nitrobenzoyl)amino]propanoate |
|---|---|
| PubChem CID | 55309521 |
| Molecular Formula | C18H15ClN4O8 |
| Molecular Weight | 450.79 g/mol |
| Exact Mass | 450.06 |
| IUPAC Name | [2-(4-chloro-2-nitroanilino)-2-oxoethyl] 2-[(3-nitrobenzoyl)amino]propanoate |
| SMILES | CC(NC(=O)c1cccc([N+](=O)[O-])c1)C(=O)OCC(=O)Nc1ccc(Cl)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C18H15ClN4O8/c1-10(20-17(25)11-3-2-4-13(7-11)22(27)28)18(26)31-9-16(24)21-14-6-5-12(19)8-15(14)23(29)30/h2-8,10H,9H2,1H3,(H,20,25)(H,21,24) |
| InChIKey | URQQFEMKEKSOQK-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 170.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.79 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|