C22H22N4O7 — CID 55936388
[2-oxo-2-[2-(2-oxopyrrolidin-1-yl)anilino]ethyl] (2S)-2-[(3-nitrobenzoyl)amino]propanoate (PubChem CID 55936388) has the molecular formula C22H22N4O7 and a molecular weight of 454.44 g/mol. Its IUPAC name is [2-oxo-2-[2-(2-oxopyrrolidin-1-yl)anilino]ethyl] (2S)-2-[(3-nitrobenzoyl)amino]propanoate.
| Compound Name | [2-oxo-2-[2-(2-oxopyrrolidin-1-yl)anilino]ethyl] (2S)-2-[(3-nitrobenzoyl)amino]propanoate |
|---|---|
| PubChem CID | 55936388 |
| Molecular Formula | C22H22N4O7 |
| Molecular Weight | 454.44 g/mol |
| Exact Mass | 454.15 |
| IUPAC Name | [2-oxo-2-[2-(2-oxopyrrolidin-1-yl)anilino]ethyl] (2S)-2-[(3-nitrobenzoyl)amino]propanoate |
| SMILES | C[C@H](NC(=O)c1cccc([N+](=O)[O-])c1)C(=O)OCC(=O)Nc1ccccc1N1CCCC1=O |
| InChI | InChI=1S/C22H22N4O7/c1-14(23-21(29)15-6-4-7-16(12-15)26(31)32)22(30)33-13-19(27)24-17-8-2-3-9-18(17)25-11-5-10-20(25)28/h2-4,6-9,12,14H,5,10-11,13H2,1H3,(H,23,29)(H,24,27)/t14-/m0/s1 |
| InChIKey | XVAPQIGLZLBRIF-AWEZNQCLSA-N |
| XLogP | 2.02 |
| TPSA | 147.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.44 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|