C22H23N3O6 — CID 55309508
[4-(pyrrolidine-1-carbonyl)phenyl]methyl 2-[(3-nitrobenzoyl)amino]propanoate (PubChem CID 55309508) has the molecular formula C22H23N3O6 and a molecular weight of 425.44 g/mol. Its IUPAC name is [4-(pyrrolidine-1-carbonyl)phenyl]methyl 2-[(3-nitrobenzoyl)amino]propanoate.
| Compound Name | [4-(pyrrolidine-1-carbonyl)phenyl]methyl 2-[(3-nitrobenzoyl)amino]propanoate |
|---|---|
| PubChem CID | 55309508 |
| Molecular Formula | C22H23N3O6 |
| Molecular Weight | 425.44 g/mol |
| Exact Mass | 425.16 |
| IUPAC Name | [4-(pyrrolidine-1-carbonyl)phenyl]methyl 2-[(3-nitrobenzoyl)amino]propanoate |
| SMILES | CC(NC(=O)c1cccc([N+](=O)[O-])c1)C(=O)OCc1ccc(C(=O)N2CCCC2)cc1 |
| InChI | InChI=1S/C22H23N3O6/c1-15(23-20(26)18-5-4-6-19(13-18)25(29)30)22(28)31-14-16-7-9-17(10-8-16)21(27)24-11-2-3-12-24/h4-10,13,15H,2-3,11-12,14H2,1H3,(H,23,26) |
| InChIKey | MGGWCHAOVUTNEZ-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 118.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.44 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|