C22H22N4O5 — CID 55928329
[4-(3,5-dimethylpyrazol-1-yl)phenyl]methyl (2S)-2-[(3-nitrobenzoyl)amino]propanoate (PubChem CID 55928329) has the molecular formula C22H22N4O5 and a molecular weight of 422.44 g/mol. Its IUPAC name is [4-(3,5-dimethylpyrazol-1-yl)phenyl]methyl (2S)-2-[(3-nitrobenzoyl)amino]propanoate.
| Compound Name | [4-(3,5-dimethylpyrazol-1-yl)phenyl]methyl (2S)-2-[(3-nitrobenzoyl)amino]propanoate |
|---|---|
| PubChem CID | 55928329 |
| Molecular Formula | C22H22N4O5 |
| Molecular Weight | 422.44 g/mol |
| Exact Mass | 422.16 |
| IUPAC Name | [4-(3,5-dimethylpyrazol-1-yl)phenyl]methyl (2S)-2-[(3-nitrobenzoyl)amino]propanoate |
| SMILES | Cc1cc(C)n(-c2ccc(COC(=O)[C@H](C)NC(=O)c3cccc([N+](=O)[O-])c3)cc2)n1 |
| InChI | InChI=1S/C22H22N4O5/c1-14-11-15(2)25(24-14)19-9-7-17(8-10-19)13-31-22(28)16(3)23-21(27)18-5-4-6-20(12-18)26(29)30/h4-12,16H,13H2,1-3H3,(H,23,27)/t16-/m0/s1 |
| InChIKey | MJRIOLLBMHJLIQ-INIZCTEOSA-N |
| XLogP | 3.26 |
| TPSA | 116.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.44 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|