C14H11Cl2N2O9- — CID 135720649
1-(2,6-dichloro-4-nitroanilino)-1-hydroxy-5-methoxy-3-methoxycarbonyl-4,5-dioxopent-1-en-2-olate (PubChem CID 135720649) has the molecular formula C14H11Cl2N2O9- and a molecular weight of 422.15 g/mol. Its IUPAC name is 1-(2,6-dichloro-4-nitroanilino)-1-hydroxy-5-methoxy-3-methoxycarbonyl-4,5-dioxopent-1-en-2-olate.
| Compound Name | 1-(2,6-dichloro-4-nitroanilino)-1-hydroxy-5-methoxy-3-methoxycarbonyl-4,5-dioxopent-1-en-2-olate |
|---|---|
| PubChem CID | 135720649 |
| Molecular Formula | C14H11Cl2N2O9- |
| Molecular Weight | 422.15 g/mol |
| Exact Mass | 420.98 |
| IUPAC Name | 1-(2,6-dichloro-4-nitroanilino)-1-hydroxy-5-methoxy-3-methoxycarbonyl-4,5-dioxopent-1-en-2-olate |
| SMILES | COC(=O)C(=O)C(C(=O)OC)C([O-])=C(O)Nc1c(Cl)cc([N+](=O)[O-])cc1Cl |
| InChI | InChI=1S/C14H12Cl2N2O9/c1-26-13(22)8(11(20)14(23)27-2)10(19)12(21)17-9-6(15)3-5(18(24)25)4-7(9)16/h3-4,8,17,19,21H,1-2H3/p-1 |
| InChIKey | WZLZBTMUNGYHHF-UHFFFAOYSA-M |
| XLogP | 0.93 |
| TPSA | 168.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.15 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|