C9H7Cl2N3O4 — CID 16640841
N-[(2,6-dichloro-4-nitrophenyl)carbamoyl]acetamide (PubChem CID 16640841) has the molecular formula C9H7Cl2N3O4 and a molecular weight of 292.08 g/mol. Its IUPAC name is N-[(2,6-dichloro-4-nitrophenyl)carbamoyl]acetamide.
| Compound Name | N-[(2,6-dichloro-4-nitrophenyl)carbamoyl]acetamide |
|---|---|
| PubChem CID | 16640841 |
| Molecular Formula | C9H7Cl2N3O4 |
| Molecular Weight | 292.08 g/mol |
| Exact Mass | 290.98 |
| IUPAC Name | N-[(2,6-dichloro-4-nitrophenyl)carbamoyl]acetamide |
| SMILES | CC(=O)NC(=O)Nc1c(Cl)cc([N+](=O)[O-])cc1Cl |
| InChI | InChI=1S/C9H7Cl2N3O4/c1-4(15)12-9(16)13-8-6(10)2-5(14(17)18)3-7(8)11/h2-3H,1H3,(H2,12,13,15,16) |
| InChIKey | LKQHYQDIHYXOMN-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 101.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.08 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|