C10H11Cl2N3O3 — CID 104917716
3-(2,6-dichloro-4-nitroanilino)butanamide (PubChem CID 104917716) has the molecular formula C10H11Cl2N3O3 and a molecular weight of 292.12 g/mol. Its IUPAC name is 3-(2,6-dichloro-4-nitroanilino)butanamide.
| Compound Name | 3-(2,6-dichloro-4-nitroanilino)butanamide |
|---|---|
| PubChem CID | 104917716 |
| Molecular Formula | C10H11Cl2N3O3 |
| Molecular Weight | 292.12 g/mol |
| Exact Mass | 291.02 |
| IUPAC Name | 3-(2,6-dichloro-4-nitroanilino)butanamide |
| SMILES | CC(CC(N)=O)Nc1c(Cl)cc([N+](=O)[O-])cc1Cl |
| InChI | InChI=1S/C10H11Cl2N3O3/c1-5(2-9(13)16)14-10-7(11)3-6(15(17)18)4-8(10)12/h3-5,14H,2H2,1H3,(H2,13,16) |
| InChIKey | PTIPIRVXNWLWPG-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 98.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.12 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|